2-methyl-4,4-diphenyl-butanoic acid structure
|
Common Name | 2-methyl-4,4-diphenyl-butanoic acid | ||
|---|---|---|---|---|
| CAS Number | 57090-82-1 | Molecular Weight | 254.32400 | |
| Density | 1.102g/cm3 | Boiling Point | 384.7ºC at 760 mmHg | |
| Molecular Formula | C17H18O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 281.5ºC | |
| Name | 2-methyl-4,4-diphenylbutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.102g/cm3 |
|---|---|
| Boiling Point | 384.7ºC at 760 mmHg |
| Molecular Formula | C17H18O2 |
| Molecular Weight | 254.32400 |
| Flash Point | 281.5ºC |
| Exact Mass | 254.13100 |
| PSA | 37.30000 |
| LogP | 3.92930 |
| Index of Refraction | 1.569 |
| InChIKey | BIEBNJKIRZWTST-UHFFFAOYSA-N |
| SMILES | CC(CC(c1ccccc1)c1ccccc1)C(=O)O |
|
~%
2-methyl-4,4-di... CAS#:57090-82-1 |
| Literature: Kofron,W.G.; Mathew,J. Journal of Organic Chemistry, 1976 , vol. 41, # 1 p. 114 - 116 |
|
~%
2-methyl-4,4-di... CAS#:57090-82-1 |
| Literature: Kofron,W.G.; Mathew,J. Journal of Organic Chemistry, 1976 , vol. 41, # 1 p. 114 - 116 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4,4-Diphenyl-2-methylbuttersaeure |