9-[3,4-dimethoxy-5-(methoxymethyl)oxolan-2-yl]-N,N-dimethyl-purin-6-amine structure
|
Common Name | 9-[3,4-dimethoxy-5-(methoxymethyl)oxolan-2-yl]-N,N-dimethyl-purin-6-amine | ||
|---|---|---|---|---|
| CAS Number | 57099-08-8 | Molecular Weight | 337.37400 | |
| Density | 1.37g/cm3 | Boiling Point | 503.3ºC at 760 mmHg | |
| Molecular Formula | C15H23N5O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 258.2ºC | |
| Name | 9-[3,4-dimethoxy-5-(methoxymethyl)oxolan-2-yl]-N,N-dimethylpurin-6-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.37g/cm3 |
|---|---|
| Boiling Point | 503.3ºC at 760 mmHg |
| Molecular Formula | C15H23N5O4 |
| Molecular Weight | 337.37400 |
| Flash Point | 258.2ºC |
| Exact Mass | 337.17500 |
| PSA | 83.76000 |
| LogP | 0.46610 |
| Index of Refraction | 1.614 |
| InChIKey | YXMRAWLSVCPKRV-UHFFFAOYSA-N |
| SMILES | COCC1OC(n2cnc3c(N(C)C)ncnc32)C(OC)C1OC |
|
~49%
Detail
|
| Literature: Pettit; Blazer; Einck; Yamauchi Journal of Organic Chemistry, 1980 , vol. 45, # 21 p. 4073 - 4076 |
|
~0%
9-[3,4-dimethox... CAS#:57099-08-8 |
| Literature: Pettit; Blazer; Einck; Yamauchi Journal of Organic Chemistry, 1980 , vol. 45, # 21 p. 4073 - 4076 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| Permethyladenosine |
| Permethyladenosin |
| 2',3',5'-N66-Pentamethyladenosin |
| N6,N6,O2',O3',O5'-pentamethyl-adenosine |