8-Methoxykaempferol structure
|
Common Name | 8-Methoxykaempferol | ||
|---|---|---|---|---|
| CAS Number | 571-74-4 | Molecular Weight | 316.26200 | |
| Density | 1.634g/cm3 | Boiling Point | 603.2ºC at 760 mmHg | |
| Molecular Formula | C16H12O7 | Melting Point | 276-278 ºC | |
| MSDS | N/A | Flash Point | 229.3ºC | |
| Name | sexangularetin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.634g/cm3 |
|---|---|
| Boiling Point | 603.2ºC at 760 mmHg |
| Melting Point | 276-278 ºC |
| Molecular Formula | C16H12O7 |
| Molecular Weight | 316.26200 |
| Flash Point | 229.3ºC |
| Exact Mass | 316.05800 |
| PSA | 120.36000 |
| LogP | 2.29100 |
| Index of Refraction | 1.74 |
| InChIKey | AZFYHRHUTXBGJS-UHFFFAOYSA-N |
| SMILES | COc1c(O)cc(O)c2c(=O)c(O)c(-c3ccc(O)cc3)oc12 |
|
~95%
8-Methoxykaempferol CAS#:571-74-4 |
| Literature: Horie; Tsukayama; Kawamura; Seno; Yamamoto Bulletin of the Chemical Society of Japan, 1988 , vol. 61, # 2 p. 441-447 |
|
~%
8-Methoxykaempferol CAS#:571-74-4 |
| Literature: Horie; Tsukayama; Kawamura; Seno; Yamamoto Bulletin of the Chemical Society of Japan, 1988 , vol. 61, # 2 p. 441-447 |
|
~%
8-Methoxykaempferol CAS#:571-74-4 |
| Literature: Dauguet, Jean-Claude; Bert, Maryse; Dolley, Jean; Bekaert, Alain; Lewin, Guy Phytochemistry (Elsevier), 1993 , vol. 33, # 6 p. 1503 - 1506 |
| 8-methylherbacetin |
| 3,5,7-trihydroxy-2-(4-hydroxyphenyl)-8-methoxychromen-4-one |
| herbacetin 8-methyl ether |
| 3,5,7,4'-tetrahydroxy-8-methoxyflavone |
| 8-(methoxy)kaempferol |
| 3,5,7-trihydroxy-2-(4-hydroxyphenyl)-8-methoxy-chromen-4-one |
| 8-Methoxykaempferol |