Ketonone B
Modify Date: 2025-12-24 17:02:47
Ketonone B structure
|
Common Name | Ketonone B | ||
|---|---|---|---|---|
| CAS Number | 571-98-2 | Molecular Weight | 282.33400 | |
| Density | 1.107g/cm3 | Boiling Point | 393.3ºC at 760 mmHg | |
| Molecular Formula | C18H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.6ºC | |
| Name | butyl 2-benzoylbenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.107g/cm3 |
|---|---|
| Boiling Point | 393.3ºC at 760 mmHg |
| Molecular Formula | C18H18O3 |
| Molecular Weight | 282.33400 |
| Flash Point | 171.6ºC |
| Exact Mass | 282.12600 |
| PSA | 43.37000 |
| LogP | 3.87450 |
| Index of Refraction | 1.554 |
| InChIKey | VMHKPGQWBDCKSM-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)c1ccccc1C(=O)c1ccccc1 |
| HS Code | 2918300090 |
|---|
|
~%
Ketonone B CAS#:571-98-2 |
| Literature: Am. Cyanamid Co. Patent: US2233513 , 1929 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
Total 2, Current Page 1 of 1
1
| n-Butyl-O-benzoyl benzoate |
| Ketonone B |
| 2-benzoyl-benzoic acid butyl ester |
| Butyl-2-benzoylbenzoat |
| 2-Benzoyl-benzoesaeure-butylester |
| Butyl o-benzoylbenzoate |