phenyl N-(3,4-dichlorophenyl)carbamate structure
|
Common Name | phenyl N-(3,4-dichlorophenyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 57148-27-3 | Molecular Weight | 282.12200 | |
| Density | 1.422g/cm3 | Boiling Point | 369.9ºC at 760 mmHg | |
| Molecular Formula | C13H9Cl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177.5ºC | |
| Name | phenyl N-(3,4-dichlorophenyl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.422g/cm3 |
|---|---|
| Boiling Point | 369.9ºC at 760 mmHg |
| Molecular Formula | C13H9Cl2NO2 |
| Molecular Weight | 282.12200 |
| Flash Point | 177.5ºC |
| Exact Mass | 281.00100 |
| PSA | 41.82000 |
| LogP | 4.61790 |
| Index of Refraction | 1.645 |
| InChIKey | MVXLHYKEKXUFFZ-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)Oc1ccccc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Phenyl 3,4-dichlorophenylcarbamate |
| (3,4-dichlorophenyl)-carbamic acid,phenyl ester |
| <3,4-Dichlor-phenyl>-carbamidsaeure-phenylester |
| Phenyl 3,4-dichlorocarbanilate |