N-(((4-Chlorophenyl)amino)carbonyl)benzamide
Modify Date: 2025-09-22 11:33:39
N-(((4-Chlorophenyl)amino)carbonyl)benzamide structure
|
Common Name | N-(((4-Chlorophenyl)amino)carbonyl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 57160-48-2 | Molecular Weight | 292.69300 | |
| Density | 1.414g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H10ClFN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[(4-chlorophenyl)carbamoyl]-2-fluorobenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.414g/cm3 |
|---|---|
| Molecular Formula | C14H10ClFN2O2 |
| Molecular Weight | 292.69300 |
| Exact Mass | 292.04100 |
| PSA | 58.20000 |
| LogP | 3.90490 |
| Index of Refraction | 1.633 |
| InChIKey | LVQASSMMTYDEIC-UHFFFAOYSA-N |
| SMILES | O=C(NC(=O)c1ccccc1F)Nc1ccc(Cl)cc1 |
| HS Code | 2924299090 |
|---|
|
~77%
N-(((4-Chloroph... CAS#:57160-48-2 |
| Literature: Kavalek, Jaromir; Kacetl, Lubomir; Kavalkova, Marcela Collection of Czechoslovak Chemical Communications, 1989 , vol. 54, # 5 p. 1363 - 1369 |
CAS#:394-35-4
CAS#:140-38-5| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-(((4-Chlorophenyl)amino)carbonyl)benzamide |
| 1-(2-fluorobenzoyl)-3-(4-chlorophenyl)urea |