ethyl 3-[(3-methoxyphenyl)amino]-3-phenyl-prop-2-enoate structure
|
Common Name | ethyl 3-[(3-methoxyphenyl)amino]-3-phenyl-prop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 57183-42-3 | Molecular Weight | 297.34800 | |
| Density | 1.152g/cm3 | Boiling Point | 447.8ºC at 760 mmHg | |
| Molecular Formula | C18H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224.6ºC | |
| Name | ethyl (E)-3-(3-methoxyanilino)-3-phenylprop-2-enoate |
|---|
| Density | 1.152g/cm3 |
|---|---|
| Boiling Point | 447.8ºC at 760 mmHg |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.34800 |
| Flash Point | 224.6ºC |
| Exact Mass | 297.13600 |
| PSA | 47.56000 |
| LogP | 3.78430 |
| Index of Refraction | 1.594 |
| InChIKey | WSNGJKIPVDHHGP-GHRIWEEISA-N |
| SMILES | CCOC(=O)C=C(Nc1cccc(OC)c1)c1ccccc1 |
|
~%
ethyl 3-[(3-met... CAS#:57183-42-3 |
| Literature: Kuo; Lee; Juang; Lin; Wu; Chang; Lednicer; Paull; Hamel Journal of Medicinal Chemistry, 1993 , vol. 36, # 9 p. 1146 - 1156 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |