1-(trifluoromethyl)-4-[[4-(trifluoromethyl)phenyl]diselanyl]benzene structure
|
Common Name | 1-(trifluoromethyl)-4-[[4-(trifluoromethyl)phenyl]diselanyl]benzene | ||
|---|---|---|---|---|
| CAS Number | 57204-86-1 | Molecular Weight | 448.12400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H8F6Se2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(trifluoromethyl)-4-[[4-(trifluoromethyl)phenyl]diselanyl]benzene |
|---|
| Molecular Formula | C14H8F6Se2 |
|---|---|
| Molecular Weight | 448.12400 |
| Exact Mass | 449.88600 |
| LogP | 2.99840 |
| InChIKey | XKFQDKUTRWVAIS-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1ccc([Se][Se]c2ccc(C(F)(F)F)cc2)cc1 |
|
~%
1-(trifluoromet... CAS#:57204-86-1 |
| Literature: Reich,H.J. et al. Journal of the American Chemical Society, 1975 , vol. 97, # 19 p. 5434 - 5447 |
|
~%
1-(trifluoromet... CAS#:57204-86-1 |
| Literature: Schmid, George H.; Garratt, Dennis G. Journal of Organic Chemistry, 1983 , vol. 48, p. 4169 - 4172 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |