[(3,5,6-trichloro-2-pyridyl)oxy]acetic acid, compound with triethylamine (1:1) structure
|
Common Name | [(3,5,6-trichloro-2-pyridyl)oxy]acetic acid, compound with triethylamine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 57213-69-1 | Molecular Weight | 357.66100 | |
| Density | N/A | Boiling Point | 359.1ºC at 760mmHg | |
| Molecular Formula | C13H19Cl3N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171ºC | |
| Name | triclopyr-triethylammonium |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 359.1ºC at 760mmHg |
|---|---|
| Molecular Formula | C13H19Cl3N2O3 |
| Molecular Weight | 357.66100 |
| Flash Point | 171ºC |
| Exact Mass | 356.04600 |
| PSA | 62.66000 |
| LogP | 3.85330 |
| InChIKey | ROKVVMOXSZIDEG-UHFFFAOYSA-N |
| SMILES | CCN(CC)CC.O=C(O)COc1nc(Cl)c(Cl)cc1Cl |
CHEMICAL IDENTIFICATION
|
| triethylammonium 3,5,6-trichloro-2-pyridyloxyacetate |
| Triethylammonium triclopyr |
| 2-[(3,5,6-trichloro-2-pyridinyl)oxy]acetic acid compound with N,N-diethylethanamine (1:1) |
| Triclopyr triethylamine salt |
| Triclopyr triethylamine |
| EINECS 260-625-1 |
| Caswell No. 882J |
| N,N-diethylethanamine,2-(3,5,6-trichloropyridin-2-yl)oxyacetic acid |
| Triclopyr triethylammonium salt |
| Garlon 3A |
| 3,5,6-trichloro-2-pyridyloxyacetic acid - triethylamine (1:1) |
| Triclopyr-triethylammonium |
| [(3,5,6-trichloropyridin-2-yl)oxy]acetic acid—N,N-diethylethan-1-amine |