5,5-dimethyl-2-oxo-N-phenyl-1,3,2λ5-dioxaphosphinan-2-amine
5,5-dimethyl-2-oxo-N-phenyl-1,3,2λ5-dioxaphosphinan-2-amine structure
|
Common Name | 5,5-dimethyl-2-oxo-N-phenyl-1,3,2λ5-dioxaphosphinan-2-amine | ||
|---|---|---|---|---|
| CAS Number | 57237-68-0 | Molecular Weight | 241.22300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H16NO3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5,5-dimethyl-2-oxo-N-phenyl-1,3,2λ5-dioxaphosphinan-2-amine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H16NO3P |
|---|---|
| Molecular Weight | 241.22300 |
| Exact Mass | 241.08700 |
| PSA | 57.37000 |
| LogP | 3.35260 |
| InChIKey | RZCCMUUZZJLWEA-UHFFFAOYSA-N |
| SMILES | CC1(C)COP(=O)(Nc2ccccc2)OC1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~93%
5,5-dimethyl-2-... CAS#:57237-68-0
Learn More
|
| Literature: Baraniak, Janina; Stec, Wojciech J. Tetrahedron Letters, 1991 , vol. 32, # 33 p. 4193 - 4196 |
|
~%
5,5-dimethyl-2-... CAS#:57237-68-0 |
| Literature: Stec,W.J. et al. Journal of Organic Chemistry, 1976 , vol. 41, # 2 p. 227 - 233 |
|
~%
5,5-dimethyl-2-... CAS#:57237-68-0 |
| Literature: Stec,W.J. et al. Journal of Organic Chemistry, 1976 , vol. 41, # 2 p. 227 - 233 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 1 | |
CAS#:1005-98-7This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 5,5-Dimethyl-2-oxo-2-aminobenzo-1,3,2-dioxaphosphorinan |
| neopentyl N-phenyl phosphoramide |
| 2-Anilino-5,5-dimethyl-2-oxo-1,3,2-dioxaphosphorinan |
| 1,3,2-Dioxaphosphorinan-2-amine,5,5-dimethyl-N-phenyl-,2-oxide |
| 5,5-dimethyl-N-phenyl-1,3,2-dioxaphosphorinan-2-amine,2-oxide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 5,5-dimethyl-2-oxo-N-phenyl-1,3,2λ5-dioxaphosphinan-2-amine? |
| A: The English name of 5,5-dimethyl-2-oxo-N-phenyl-1,3,2λ5-dioxaphosphinan-2-amine is 5,5-dimethyl-2-oxo-N-phenyl-1,3,2λ5-dioxaphosphinan-2-amine. |
| Q: What is the InChIKey of 5,5-dimethyl-2-oxo-N-phenyl-1,3,2λ5-dioxaphosphinan-2-amine? |
| A: InChIKey of 5,5-dimethyl-2-oxo-N-phenyl-1,3,2λ5-dioxaphosphinan-2-amine is RZCCMUUZZJLWEA-UHFFFAOYSA-N. |
| Q: What is the CAS number of 5,5-dimethyl-2-oxo-N-phenyl-1,3,2λ5-dioxaphosphinan-2-amine? |
| A: CAS number of 5,5-dimethyl-2-oxo-N-phenyl-1,3,2λ5-dioxaphosphinan-2-amine is 57237-68-0. |
| Q: What is the molecular formula of 5,5-dimethyl-2-oxo-N-phenyl-1,3,2λ5-dioxaphosphinan-2-amine? |
| A: Molecular formula of 5,5-dimethyl-2-oxo-N-phenyl-1,3,2λ5-dioxaphosphinan-2-amine is C11H16NO3P. |
| Q: What is the polar surface area (PSA) of 5,5-dimethyl-2-oxo-N-phenyl-1,3,2λ5-dioxaphosphinan-2-amine? |
| A: Polar surface area (PSA) of 5,5-dimethyl-2-oxo-N-phenyl-1,3,2λ5-dioxaphosphinan-2-amine is 57.37000. |
| Q: What is the molecular weight of 5,5-dimethyl-2-oxo-N-phenyl-1,3,2λ5-dioxaphosphinan-2-amine? |
| A: Molecular weight of 5,5-dimethyl-2-oxo-N-phenyl-1,3,2λ5-dioxaphosphinan-2-amine is 241.22300. |
| Q: What is the LogP of 5,5-dimethyl-2-oxo-N-phenyl-1,3,2λ5-dioxaphosphinan-2-amine? |
| A: LogP of 5,5-dimethyl-2-oxo-N-phenyl-1,3,2λ5-dioxaphosphinan-2-amine is 3.35260. |
| Q: What are the upstream materials of 5,5-dimethyl-2-oxo-N-phenyl-1,3,2λ5-dioxaphosphinan-2-amine? |
| A: Related upstream materials(CAS) of 5,5-dimethyl-2-oxo-N-phenyl-1,3,2λ5-dioxaphosphinan-2-amine: 2428-06-0. |
| Q: What is the Chinese name of 57237-68-0? |
| A: Chinese name of 57237-68-0 is 57237-68-0. |
| Q: What are the downstream products of 5,5-dimethyl-2-oxo-N-phenyl-1,3,2λ5-dioxaphosphinan-2-amine? |
| A: Related downstream products(CAS) of 5,5-dimethyl-2-oxo-N-phenyl-1,3,2λ5-dioxaphosphinan-2-amine: 1005-98-7. |