[3-(3,5-dinitrobenzoyl)oxyphenyl] 3,5-dinitrobenzoate structure
|
Common Name | [3-(3,5-dinitrobenzoyl)oxyphenyl] 3,5-dinitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 5724-01-6 | Molecular Weight | 498.31300 | |
| Density | 1.641g/cm3 | Boiling Point | 701.9ºC at 760mmHg | |
| Molecular Formula | C20H10N4O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 290.2ºC | |
| Name | [3-(3,5-dinitrobenzoyl)oxyphenyl] 3,5-dinitrobenzoate |
|---|
| Density | 1.641g/cm3 |
|---|---|
| Boiling Point | 701.9ºC at 760mmHg |
| Molecular Formula | C20H10N4O12 |
| Molecular Weight | 498.31300 |
| Flash Point | 290.2ºC |
| Exact Mass | 498.03000 |
| PSA | 235.88000 |
| LogP | 5.85060 |
| Index of Refraction | 1.687 |
| InChIKey | KMJDWCTWZVPRIA-UHFFFAOYSA-N |
| SMILES | O=C(Oc1cccc(OC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)c1)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
|
~%
[3-(3,5-dinitro... CAS#:5724-01-6 |
| Literature: Lamb,R.C. et al. Journal of Organic Chemistry, 1966 , vol. 31, p. 147 - 153 |
|
~%
[3-(3,5-dinitro... CAS#:5724-01-6 |
| Literature: Lamb,R.C. et al. Journal of Organic Chemistry, 1966 , vol. 31, p. 147 - 153 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |