ethyl 4,6-dichloro-2-methyl-5-nitropyridine-3-carboxylate structure
|
Common Name | ethyl 4,6-dichloro-2-methyl-5-nitropyridine-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 57268-81-2 | Molecular Weight | 279.07700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H8Cl2N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 4,6-dichloro-2-methyl-5-nitropyridine-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H8Cl2N2O4 |
|---|---|
| Molecular Weight | 279.07700 |
| Exact Mass | 277.98600 |
| PSA | 85.01000 |
| LogP | 3.30490 |
| InChIKey | GKCNAXFKWLOVMQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c(C)nc(Cl)c([N+](=O)[O-])c1Cl |
|
~55%
ethyl 4,6-dichl... CAS#:57268-81-2 |
| Literature: E. R. Squibb and Sons, Inc. Patent: US3984412 A1, 1976 ; |
|
~%
ethyl 4,6-dichl... CAS#:57268-81-2 |
| Literature: E. R. Squibb and Sons, Inc. Patent: US3953461 A1, 1976 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 4,6-dichloro-2-methyl-5-nitronicotinic acid ethyl ester |
| 4,6-Dichloro2methyl-5-nitropyridine-3-carboxylic acid ethyl ester |
| 3-Pyridinecarboxylic acid,4,6-dichloro-2-methyl-5-nitro-,ethyl ester |