5-[(2-chlorophenyl)methylidene]-1,3-diazinane-2,4,6-trione structure
|
Common Name | 5-[(2-chlorophenyl)methylidene]-1,3-diazinane-2,4,6-trione | ||
|---|---|---|---|---|
| CAS Number | 57270-78-7 | Molecular Weight | 250.63800 | |
| Density | 1.494g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H7ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-[(2-chlorophenyl)methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.494g/cm3 |
|---|---|
| Molecular Formula | C11H7ClN2O3 |
| Molecular Weight | 250.63800 |
| Exact Mass | 250.01500 |
| PSA | 75.27000 |
| LogP | 1.74700 |
| Index of Refraction | 1.648 |
| InChIKey | FMAIJMYTMYNJHJ-UHFFFAOYSA-N |
| SMILES | O=C1NC(=O)C(=Cc2ccccc2Cl)C(=O)N1 |
|
~97%
5-[(2-chlorophe... CAS#:57270-78-7 |
| Literature: Figueroa-Villar, J. Daniel; Vieira, Andreia A. Journal of Molecular Structure, 2013 , vol. 1034, p. 310 - 317 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| o-chlorobenzylidene barbiturate |