(S)-4-(1-HYDROXYMETHYL-PROPYLAMINO)BENZONITRILE structure
|
Common Name | (S)-4-(1-HYDROXYMETHYL-PROPYLAMINO)BENZONITRILE | ||
|---|---|---|---|---|
| CAS Number | 572923-17-2 | Molecular Weight | 324.37400 | |
| Density | 1.206g/cm3 | Boiling Point | 528.369ºC at 760 mmHg | |
| Molecular Formula | C19H20N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 273.348ºC | |
| Name | 4-[(4S)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]-N-propylbenzamide |
|---|
| Density | 1.206g/cm3 |
|---|---|
| Boiling Point | 528.369ºC at 760 mmHg |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.37400 |
| Flash Point | 273.348ºC |
| Exact Mass | 324.14700 |
| PSA | 58.64000 |
| LogP | 3.98020 |
| Index of Refraction | 1.591 |
| InChIKey | VOBPGZCPEAAYTA-QGZVFWFLSA-N |
| SMILES | CCCNC(=O)c1ccc(N2C(=O)OCC2c2ccccc2)cc1 |
|
~95%
(S)-4-(1-HYDROX... CAS#:572923-17-2 |
| Literature: Ghosh, Arun; Sieser, Janice E.; Riou, Maxime; Cai, Weiling; Rivera-Ruiz, Luis Organic Letters, 2003 , vol. 5, # 13 p. 2207 - 2210 |
|
~97%
(S)-4-(1-HYDROX... CAS#:572923-17-2 |
| Literature: Ghosh, Arun; Sieser, Janice E.; Caron, Stephane; Couturier, Michel; Dupont-Gaudet, Kristina; Girardin, Melina Journal of Organic Chemistry, 2006 , vol. 71, # 3 p. 1258 - 1261 |
|
~%
(S)-4-(1-HYDROX... CAS#:572923-17-2 |
| Literature: Ghosh, Arun; Sieser, Janice E.; Caron, Stephane; Couturier, Michel; Dupont-Gaudet, Kristina; Girardin, Melina Journal of Organic Chemistry, 2006 , vol. 71, # 3 p. 1258 - 1261 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |