(2,3,4,5,6-pentahydroxycyclohexyl) dihydrogen phosphate
Modify Date: 2025-08-26 09:42:04
(2,3,4,5,6-pentahydroxycyclohexyl) dihydrogen phosphate structure
|
Common Name | (2,3,4,5,6-pentahydroxycyclohexyl) dihydrogen phosphate | ||
|---|---|---|---|---|
| CAS Number | 573-35-3 | Molecular Weight | 260.13600 | |
| Density | 2.02g/cm3 | Boiling Point | 517.4ºC at 760mmHg | |
| Molecular Formula | C6H13O9P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 266.7ºC | |
| Name | (2,3,4,5,6-pentahydroxycyclohexyl) dihydrogen phosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 2.02g/cm3 |
|---|---|
| Boiling Point | 517.4ºC at 760mmHg |
| Molecular Formula | C6H13O9P |
| Molecular Weight | 260.13600 |
| Flash Point | 266.7ºC |
| Exact Mass | 260.03000 |
| PSA | 177.72000 |
| InChIKey | INAPMGSXUVUWAF-GCVPSNMTSA-N |
| SMILES | O=P(O)(O)OC1C(O)C(O)C(O)C(O)C1O |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:551-72-4
CAS#:7664-38-2|
Name: EZH2/PRC2 methyltransferase inhibitors Measured in Biochemical System Using Plate Rea...
Source: Broad Institute
Target: histone-lysine N-methyltransferase EZH2 isoform a [Homo sapiens]
External Id: 2125-01_Inhibitor_SinglePoint_HTS_Activity
|
|
Name: IMPase-catalyzed hydrolysis at pH 9.00 at 25 degrees Centigrade.
Source: ChEMBL
Target: N/A
External Id: CHEMBL637506
|
|
Name: Inhibition of Phosphoinositide specific phospholipase C (PI-PLC) from Bacillus cereus...
Source: ChEMBL
Target: N/A
External Id: CHEMBL768909
|
|
Name: Discovering small molecule activators of G protein-gated inwardly-rectifying potassiu...
Source: 15621
Target: G protein-activated inward rectifier potassium channel 2
External Id: VANDERBILT_HTS_GIRK2_MPD
|
|
Name: Compound was tested for the inhibition of Phosphatidylinositol-Specific Phospholipase...
Source: ChEMBL
Target: N/A
External Id: CHEMBL878092
|
|
Name: Compound was tested for the inhibition of Phosphoinositide specific phospholipase C (...
Source: ChEMBL
Target: N/A
External Id: CHEMBL768908
|
Total 6, Current Page 1 of 1
1
| inositol-2-monophosphate |
| INOSITOL MONOPHOSPHATE |
| myo-inositol 2-phosphate,free acid |
| myo-inositol 2-monophosphate |
| D-myo-inositol 2-monophosphate |
| 2,3,4,5,6-pentahydroxycyclohexyldihydrogen-phosphat |
| myo-Inositol 2-phosphate |