2,2'-azoxybisbenzoic acid
2,2'-azoxybisbenzoic acid structure
|
Common Name | 2,2'-azoxybisbenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 573-79-5 | Molecular Weight | 286.24000 | |
| Density | 1.41g/cm3 | Boiling Point | 567.4ºC at 760mmHg | |
| Molecular Formula | C14H10N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 297ºC | |
Summary: 2,2'-azoxybisbenzoic acid (2-羧基苯基-2-羧基苯基亚氨基氧鎓) with CAS number 573-79-5, has a molecular formula of C14H10N2O5 and a molecular weight of 286.24000. The density is 1.41g/cm3 and the boiling point is 567.4ºC. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2-carboxyphenyl)-(2-carboxyphenyl)imino-oxidoazanium |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.41g/cm3 |
|---|---|
| Boiling Point | 567.4ºC at 760mmHg |
| Molecular Formula | C14H10N2O5 |
| Molecular Weight | 286.24000 |
| Flash Point | 297ºC |
| Exact Mass | 286.05900 |
| PSA | 115.71000 |
| LogP | 3.53190 |
| Index of Refraction | 1.641 |
| InChIKey | MBUVKGDWMUDLBP-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccccc1N=[N+]([O-])c1ccccc1C(=O)O |
| Storage condition | 2-8℃ |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 9 | |
|---|---|
| DownStream 1 | |
CAS#:118-92-3
CAS#:552-16-9
CAS#:50-99-7
CAS#:612-25-9
CAS#:552-89-6
CAS#:54095-36-2
CAS#:579-73-7
CAS#:153258-89-0
CAS#:612-27-1
CAS#:2130-56-5This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| azoxybenzene-2,2'-dicarboxylic acid |
| 2,2'-dicarboxyazoxybenzene |
| 2,2'-Azoxy-di-benzoesaeure |
| Bis-(2-carboxy-phenyl)-diazen-N-oxid |
| 2,2'-azoxy-di-benzoic acid |
| Benzoic acid,2,2'-(1-oxido-1,2-diazenediyl)bis |
| [2.2']Azoxybenzoesaeure |
| 2,2'-oxydiazenediyl-bis-benzoic acid |
| 2-[(z)-(2-carboxyphenyl)-nno-azoxy]benzoic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of (2-carboxyphenyl)-(2-carboxyphenyl)imino-oxidoazanium? |
| A: Related downstream products(CAS) of (2-carboxyphenyl)-(2-carboxyphenyl)imino-oxidoazanium: 2130-56-5. |
| Q: What is the polar surface area (PSA) of (2-carboxyphenyl)-(2-carboxyphenyl)imino-oxidoazanium? |
| A: Polar surface area (PSA) of (2-carboxyphenyl)-(2-carboxyphenyl)imino-oxidoazanium is 115.71000. |
| Q: What English synonyms does (2-carboxyphenyl)-(2-carboxyphenyl)imino-oxidoazanium have? |
| A: English synonyms of (2-carboxyphenyl)-(2-carboxyphenyl)imino-oxidoazanium: azoxybenzene-2,2'-dicarboxylic acid, 2,2'-dicarboxyazoxybenzene, 2,2'-Azoxy-di-benzoesaeure, Bis-(2-carboxy-phenyl)-diazen-N-oxid, 2,2'-azoxy-di-benzoic acid, Benzoic acid,2,2'-(1-oxido-1,2-diazenediyl)bis, [2.2']Azoxybenzoesaeure, 2,2'-oxydiazenediyl-bis-benzoic acid, 2-[(z)-(2-carboxyphenyl)-nno-azoxy]benzoic acid. |
| Q: What is the molecular formula of (2-carboxyphenyl)-(2-carboxyphenyl)imino-oxidoazanium? |
| A: Molecular formula of (2-carboxyphenyl)-(2-carboxyphenyl)imino-oxidoazanium is C14H10N2O5. |
| Q: What is the SMILES notation of (2-carboxyphenyl)-(2-carboxyphenyl)imino-oxidoazanium? |
| A: SMILES notation of (2-carboxyphenyl)-(2-carboxyphenyl)imino-oxidoazanium is O=C(O)c1ccccc1N=[N+]([O-])c1ccccc1C(=O)O. |
| Q: What is the English name of (2-carboxyphenyl)-(2-carboxyphenyl)imino-oxidoazanium? |
| A: The English name of (2-carboxyphenyl)-(2-carboxyphenyl)imino-oxidoazanium is (2-carboxyphenyl)-(2-carboxyphenyl)imino-oxidoazanium. |
| Q: What are the upstream materials of (2-carboxyphenyl)-(2-carboxyphenyl)imino-oxidoazanium? |
| A: Related upstream materials(CAS) of (2-carboxyphenyl)-(2-carboxyphenyl)imino-oxidoazanium: 118-92-3;552-16-9;50-99-7;612-25-9;552-89-6;54095-36-2;579-73-7;153258-89-0;612-27-1. |
| Q: What is the InChIKey of (2-carboxyphenyl)-(2-carboxyphenyl)imino-oxidoazanium? |
| A: InChIKey of (2-carboxyphenyl)-(2-carboxyphenyl)imino-oxidoazanium is MBUVKGDWMUDLBP-UHFFFAOYSA-N. |
| Q: What is the CAS number of (2-carboxyphenyl)-(2-carboxyphenyl)imino-oxidoazanium? |
| A: CAS number of (2-carboxyphenyl)-(2-carboxyphenyl)imino-oxidoazanium is 573-79-5. |
| Q: What is the boiling point of (2-carboxyphenyl)-(2-carboxyphenyl)imino-oxidoazanium? |
| A: Boiling point of (2-carboxyphenyl)-(2-carboxyphenyl)imino-oxidoazanium is 567.4ºC at 760mmHg. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |