Sorbophenone, 2-hydroxy-4-methoxy-, E,E
Sorbophenone, 2-hydroxy-4-methoxy-, E,E structure
|
Common Name | Sorbophenone, 2-hydroxy-4-methoxy-, E,E | ||
|---|---|---|---|---|
| CAS Number | 57309-79-2 | Molecular Weight | 218.24800 | |
| Density | 1.109g/cm3 | Boiling Point | 390.8ºC at 760 mmHg | |
| Molecular Formula | C13H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 149.5ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Sorbophenone, 2'-hydroxy-4'-methoxy-, E,E |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.109g/cm3 |
|---|---|
| Boiling Point | 390.8ºC at 760 mmHg |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.24800 |
| Flash Point | 149.5ºC |
| Exact Mass | 218.09400 |
| PSA | 46.53000 |
| LogP | 2.71580 |
| Index of Refraction | 1.558 |
| InChIKey | NWVHMNPNVNFNFQ-VNKDHWASSA-N |
| SMILES | CC=CC=CC(=O)c1ccc(OC)cc1O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
Sorbophenone, 2... CAS#:57309-79-2 |
| Literature: Bigi, Franca; Casiraghi, Giovanni; Casnati, Giuseppe; Marchesi, Stefania; Sartori, Giovanni; Vignali, Carlo Tetrahedron, 1984 , vol. 40, # 20 p. 4081 - 4084 |
|
~%
Sorbophenone, 2... CAS#:57309-79-2 |
| Literature: Kuhn; Staab Chemische Berichte, 1954 , vol. 87, p. 262,264 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 4 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2'-Hydroxy-4'-methoxy-(E,E)-sorbophenon |
| 1-(2'-hydroxy-4'-methoxyphenyl)-3-(4''-hydroxy-3''-methyoxyphenyl)-propane |
| griffithane F |
| 1-(2-hydroxy-4-methoxyphenyl)-3-(4-hydroxy-3-methoxyphenyl)propane |
| Phenol,4-[3-(2-hydroxy-4-methoxyphenyl)propyl]-2-methoxy |
| 5-methoxy-2-sorbylphenol |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of Sorbophenone, 2'-hydroxy-4'-methoxy-, E,E? |
| A: Molecular formula of Sorbophenone, 2'-hydroxy-4'-methoxy-, E,E is C13H14O3. |
| Q: What is the InChIKey of Sorbophenone, 2'-hydroxy-4'-methoxy-, E,E? |
| A: InChIKey of Sorbophenone, 2'-hydroxy-4'-methoxy-, E,E is NWVHMNPNVNFNFQ-VNKDHWASSA-N. |
| Q: What is the boiling point of Sorbophenone, 2'-hydroxy-4'-methoxy-, E,E? |
| A: Boiling point of Sorbophenone, 2'-hydroxy-4'-methoxy-, E,E is 390.8ºC at 760 mmHg. |
| Q: What English synonyms does Sorbophenone, 2'-hydroxy-4'-methoxy-, E,E have? |
| A: English synonyms of Sorbophenone, 2'-hydroxy-4'-methoxy-, E,E: 2'-Hydroxy-4'-methoxy-(E,E)-sorbophenon, 1-(2'-hydroxy-4'-methoxyphenyl)-3-(4''-hydroxy-3''-methyoxyphenyl)-propane, griffithane F, 1-(2-hydroxy-4-methoxyphenyl)-3-(4-hydroxy-3-methoxyphenyl)propane, Phenol,4-[3-(2-hydroxy-4-methoxyphenyl)propyl]-2-methoxy, 5-methoxy-2-sorbylphenol. |
| Q: What is the LogP of Sorbophenone, 2'-hydroxy-4'-methoxy-, E,E? |
| A: LogP of Sorbophenone, 2'-hydroxy-4'-methoxy-, E,E is 2.71580. |
| Q: What is the English name of Sorbophenone, 2'-hydroxy-4'-methoxy-, E,E? |
| A: The English name of Sorbophenone, 2'-hydroxy-4'-methoxy-, E,E is Sorbophenone, 2'-hydroxy-4'-methoxy-, E,E. |
| Q: What is the SMILES notation of Sorbophenone, 2'-hydroxy-4'-methoxy-, E,E? |
| A: SMILES notation of Sorbophenone, 2'-hydroxy-4'-methoxy-, E,E is CC=CC=CC(=O)c1ccc(OC)cc1O. |
| Q: What are the upstream materials of Sorbophenone, 2'-hydroxy-4'-methoxy-, E,E? |
| A: Related upstream materials(CAS) of Sorbophenone, 2'-hydroxy-4'-methoxy-, E,E: 150-19-6;2614-88-2;123-73-9;60965-23-3. |
| Q: What is the Chinese name of 57309-79-2? |
| A: Chinese name of 57309-79-2 is 57309-79-2. |
| Q: What is the CAS number of Sorbophenone, 2'-hydroxy-4'-methoxy-, E,E? |
| A: CAS number of Sorbophenone, 2'-hydroxy-4'-methoxy-, E,E is 57309-79-2. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |