2-[4-(2,6-dimethoxyphenoxy)butoxy]-1,3-dimethoxybenzene structure
|
Common Name | 2-[4-(2,6-dimethoxyphenoxy)butoxy]-1,3-dimethoxybenzene | ||
|---|---|---|---|---|
| CAS Number | 5732-22-9 | Molecular Weight | 362.41700 | |
| Density | 1.107g/cm3 | Boiling Point | 473.4ºC at 760 mmHg | |
| Molecular Formula | C20H26O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.6ºC | |
| Name | 2-[4-(2,6-dimethoxyphenoxy)butoxy]-1,3-dimethoxybenzene |
|---|
| Density | 1.107g/cm3 |
|---|---|
| Boiling Point | 473.4ºC at 760 mmHg |
| Molecular Formula | C20H26O6 |
| Molecular Weight | 362.41700 |
| Flash Point | 189.6ºC |
| Exact Mass | 362.17300 |
| PSA | 55.38000 |
| LogP | 3.95900 |
| Index of Refraction | 1.521 |
| InChIKey | OPLJXPDURIJVPJ-UHFFFAOYSA-N |
| SMILES | COc1cccc(OC)c1OCCCCOc1c(OC)cccc1OC |
|
~%
2-[4-(2,6-dimet... CAS#:5732-22-9 |
| Literature: Smiles; Hart Journal of the Chemical Society, 1923 , vol. 123, p. 2911 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |