Benzyl N-[(1R)-1-(hydrazinecarbonyl)-ethyl]carbamate
Modify Date: 2025-08-25 15:54:03
![Benzyl N-[(1R)-1-(hydrazinecarbonyl)-ethyl]carbamate Structure](https://image.chemsrc.com/caspic/335/57355-13-2.png)
Benzyl N-[(1R)-1-(hydrazinecarbonyl)-ethyl]carbamate structure
|
Common Name | Benzyl N-[(1R)-1-(hydrazinecarbonyl)-ethyl]carbamate | ||
|---|---|---|---|---|
| CAS Number | 57355-13-2 | Molecular Weight | 237.25500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H15N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Benzyl [(2R)-1-hydrazino-1-oxo-2-propanyl]carbamate (non-preferre d name) |
|---|
| Molecular Formula | C11H15N3O3 |
|---|---|
| Molecular Weight | 237.25500 |
| Exact Mass | 237.11100 |
| PSA | 100.43000 |
| LogP | 2.03620 |
| InChIKey | YEORTSCBVGBQMJ-MRVPVSSYSA-N |
| SMILES | CC(NC(=O)OCc1ccccc1)C(=O)NN |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |