[bis(2,4-dichlorophenoxyacetoxy)iodo]benzene
![[bis(2,4-dichlorophenoxyacetoxy)iodo]benzene Structure](https://image.chemsrc.com/caspic/474/57357-22-9.png)
[bis(2,4-dichlorophenoxyacetoxy)iodo]benzene structure
|
Common Name | [bis(2,4-dichlorophenoxyacetoxy)iodo]benzene | ||
|---|---|---|---|---|
| CAS Number | 57357-22-9 | Molecular Weight | 644.06700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H15Cl4IO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [bis(2,4-dichlorophenoxyacetoxy)iodo]benzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C22H15Cl4IO6 |
|---|---|
| Molecular Weight | 644.06700 |
| Exact Mass | 641.86700 |
| PSA | 71.06000 |
| LogP | 7.05060 |
| InChIKey | IYMOANHGQDMEGD-UHFFFAOYSA-N |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)OI(OC(=O)COc1ccc(Cl)cc1Cl)c1ccccc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 5 | |
CAS#:94-75-7
CAS#:591-50-4
CAS#:5253-45-2
CAS#:83143-98-0
CAS#:120-83-2This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| [Bis-(2,4-dichlorphenoxyacetyloxy)-jod]-benzol |
| [Bis-(2,4-dichlorphenoxyacetyloxy)-jod]-benzol |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of [bis(2,4-dichlorophenoxyacetoxy)iodo]benzene? |
| A: Related downstream products(CAS) of [bis(2,4-dichlorophenoxyacetoxy)iodo]benzene: 94-75-7;591-50-4;5253-45-2;83143-98-0;120-83-2. |
| Q: What is the molecular weight of [bis(2,4-dichlorophenoxyacetoxy)iodo]benzene? |
| A: Molecular weight of [bis(2,4-dichlorophenoxyacetoxy)iodo]benzene is 644.06700. |
| Q: What is the InChIKey of [bis(2,4-dichlorophenoxyacetoxy)iodo]benzene? |
| A: InChIKey of [bis(2,4-dichlorophenoxyacetoxy)iodo]benzene is IYMOANHGQDMEGD-UHFFFAOYSA-N. |
| Q: What is the English name of [bis(2,4-dichlorophenoxyacetoxy)iodo]benzene? |
| A: The English name of [bis(2,4-dichlorophenoxyacetoxy)iodo]benzene is [bis(2,4-dichlorophenoxyacetoxy)iodo]benzene. |
| Q: What is the LogP of [bis(2,4-dichlorophenoxyacetoxy)iodo]benzene? |
| A: LogP of [bis(2,4-dichlorophenoxyacetoxy)iodo]benzene is 7.05060. |
| Q: What is the Chinese name of 57357-22-9? |
| A: Chinese name of 57357-22-9 is 57357-22-9. |
| Q: What English synonyms does [bis(2,4-dichlorophenoxyacetoxy)iodo]benzene have? |
| A: English synonyms of [bis(2,4-dichlorophenoxyacetoxy)iodo]benzene: [Bis-(2,4-dichlorphenoxyacetyloxy)-jod]-benzol, [Bis-(2,4-dichlorphenoxyacetyloxy)-jod]-benzol. |
| Q: What is the SMILES notation of [bis(2,4-dichlorophenoxyacetoxy)iodo]benzene? |
| A: SMILES notation of [bis(2,4-dichlorophenoxyacetoxy)iodo]benzene is O=C(COc1ccc(Cl)cc1Cl)OI(OC(=O)COc1ccc(Cl)cc1Cl)c1ccccc1. |
| Q: What is the polar surface area (PSA) of [bis(2,4-dichlorophenoxyacetoxy)iodo]benzene? |
| A: Polar surface area (PSA) of [bis(2,4-dichlorophenoxyacetoxy)iodo]benzene is 71.06000. |
| Q: What is the molecular formula of [bis(2,4-dichlorophenoxyacetoxy)iodo]benzene? |
| A: Molecular formula of [bis(2,4-dichlorophenoxyacetoxy)iodo]benzene is C22H15Cl4IO6. |