4-tert-butyl-N-[(2,4,6-trimethoxyphenyl)methylideneamino]benzamide structure
|
Common Name | 4-tert-butyl-N-[(2,4,6-trimethoxyphenyl)methylideneamino]benzamide | ||
|---|---|---|---|---|
| CAS Number | 5737-54-2 | Molecular Weight | 370.44200 | |
| Density | 1.09g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C21H26N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-tert-butyl-N-[(2,4,6-trimethoxyphenyl)methylideneamino]benzamide |
|---|
| Density | 1.09g/cm3 |
|---|---|
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.44200 |
| Exact Mass | 370.18900 |
| PSA | 72.64000 |
| LogP | 4.34860 |
| Index of Refraction | 1.528 |
| InChIKey | LATYEPIENRZLFB-UHFFFAOYSA-N |
| SMILES | COc1cc(OC)c(C=NNC(=O)c2ccc(C(C)(C)C)cc2)c(OC)c1 |
|
~65%
4-tert-butyl-N-... CAS#:5737-54-2 |
| Literature: Gmelin Handbook: Sn: Org.Verb.1, 1.1.1.16.2, page 164 - 164 |
|
~%
4-tert-butyl-N-... CAS#:5737-54-2 |
| Literature: Wharf, Ivor; Simard, Michel G. Journal of Organometallic Chemistry, 1997 , vol. 532, # 1-2 p. 1 - 9 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |