N-(3-chloro-4-methylphenyl)-4-[(N-methylsulfonylanilino)methyl]benzamide structure
|
Common Name | N-(3-chloro-4-methylphenyl)-4-[(N-methylsulfonylanilino)methyl]benzamide | ||
|---|---|---|---|---|
| CAS Number | 5737-68-8 | Molecular Weight | 428.93200 | |
| Density | 1.356g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C22H21ClN2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(3-chloro-4-methylphenyl)-4-[(N-methylsulfonylanilino)methyl]benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.356g/cm3 |
|---|---|
| Molecular Formula | C22H21ClN2O3S |
| Molecular Weight | 428.93200 |
| Exact Mass | 428.09600 |
| PSA | 74.86000 |
| LogP | 6.02070 |
| Index of Refraction | 1.654 |
| InChIKey | ZHUGZWMPTLUQIN-UHFFFAOYSA-N |
| SMILES | Cc1ccc(NC(=O)c2ccc(CN(c3ccccc3)S(C)(=O)=O)cc2)cc1Cl |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| butyl-(2,7-di-piperidin-1-yl-pyrimido[4,5-d]pyrimidin-4-yl)-amine |
| N-(3-CHLORO-4-METHYL-PHENYL)-4-[(METHYLSULFONYL-PHENYL-AMINO)METHYL]BENZAMIDE |