(6-chloro-4-phenylquinazolin-2-yl)hydrazine structure
|
Common Name | (6-chloro-4-phenylquinazolin-2-yl)hydrazine | ||
|---|---|---|---|---|
| CAS Number | 57370-20-4 | Molecular Weight | 270.71700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H11ClN4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (6-chloro-4-phenylquinazolin-2-yl)hydrazine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H11ClN4 |
|---|---|
| Molecular Weight | 270.71700 |
| Exact Mass | 270.06700 |
| PSA | 63.83000 |
| LogP | 4.00910 |
| InChIKey | XZEPOFNTLFSHFB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=NC3=C2C=C(C=C3)Cl)NN |
|
~%
(6-chloro-4-phe... CAS#:57370-20-4 |
| Literature: Sumitomo Chemical Company, Limited Patent: US4002755 A1, 1977 ; |
|
~%
(6-chloro-4-phe... CAS#:57370-20-4 |
| Literature: Kamal, Ahmed; Reddy, A. V. N.; Sattur, P. B. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1985 , vol. 24, p. 414 - 418 |
|
~%
(6-chloro-4-phe... CAS#:57370-20-4 |
| Literature: Kamal, Ahmed; Reddy, A. V. N.; Sattur, P. B. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1985 , vol. 24, p. 414 - 418 |
|
~%
(6-chloro-4-phe... CAS#:57370-20-4 |
| Literature: Pfeifer; Niepel; Franke Pharmazie, 1989 , vol. 44, # 1 p. 63 - 64 |
| 6-Chlor-4-phenyl-2-hydrazinochinazolin |
| HMS1476M04 |
| 2-hydrazino-4-phenyl-6-chloroquinazoline |
| HMS2804K23 |
| 2-Hydrazino-4-phenyl-6-chlorchinazolin |
| 6-chloro-2-hydrazino-4-phenyl-quinazoline |
| 6-Chlor-2-hydrazino-4-phenylchinazolin |