1-pentyl-3,1-benzoxazine-2,4-dione structure
|
Common Name | 1-pentyl-3,1-benzoxazine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 57384-48-2 | Molecular Weight | 233.26300 | |
| Density | 1.175g/cm3 | Boiling Point | 350.8ºC at 760 mmHg | |
| Molecular Formula | C13H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 166ºC | |
| Name | 1-pentyl-3,1-benzoxazine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.175g/cm3 |
|---|---|
| Boiling Point | 350.8ºC at 760 mmHg |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.26300 |
| Flash Point | 166ºC |
| Exact Mass | 233.10500 |
| PSA | 52.21000 |
| LogP | 2.14490 |
| Index of Refraction | 1.542 |
| InChIKey | JRKZMGQUTSBYPR-UHFFFAOYSA-N |
| SMILES | CCCCCN1C2=CC=CC=C2C(=O)OC1=O |
|
~71%
1-pentyl-3,1-be... CAS#:57384-48-2 |
| Literature: Wube, Abraham A.; Bucar, Franz; Hochfellner, Christina; Blunder, Martina; Bauer, Rudolf; Huefner, Antje European Journal of Medicinal Chemistry, 2011 , vol. 46, # 6 p. 2091 - 2101 |
|
~43%
1-pentyl-3,1-be... CAS#:57384-48-2 |
| Literature: KAKEN PHARMACEUTICAL CO., LTD. Patent: EP2168951 A1, 2010 ; Location in patent: Page/Page column 47 ; |
|
~%
1-pentyl-3,1-be... CAS#:57384-48-2 |
| Literature: Hardtmann; Koletar; Pfister Journal of Heterocyclic Chemistry, 1975 , vol. 12, # 3 p. 565 - 572 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| N-pentylisatoic acid anhydride |
| Benz-3,1-oxazine-2,4-dione,1-pentyl |