1-Propanone,1-(4-chlorophenyl)-3-phenyl structure
|
Common Name | 1-Propanone,1-(4-chlorophenyl)-3-phenyl | ||
|---|---|---|---|---|
| CAS Number | 5739-37-7 | Molecular Weight | 244.71600 | |
| Density | 1.164g/cm3 | Boiling Point | 386ºC at 760mmHg | |
| Molecular Formula | C15H13ClO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.7ºC | |
| Name | 1-(4-chlorophenyl)-3-phenylpropan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.164g/cm3 |
|---|---|
| Boiling Point | 386ºC at 760mmHg |
| Molecular Formula | C15H13ClO |
| Molecular Weight | 244.71600 |
| Flash Point | 214.7ºC |
| Exact Mass | 244.06500 |
| PSA | 17.07000 |
| LogP | 4.15550 |
| Index of Refraction | 1.583 |
| InChIKey | GQNOPFDKLUGQEC-UHFFFAOYSA-N |
| SMILES | O=C(CCc1ccccc1)c1ccc(Cl)cc1 |
| HS Code | 2914700090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 1 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 1-(4-Chlor-phenyl)-3-phenyl-propan-1-on |
| 1-(4-chloro-phenyl)-3-phenyl-propan-1-one |
| 1-(4-chlorophenyl)-3-phenyl-1-propanone |
| 4'-CHLORO-3-PHENYLPROPIOPHENONE |