3-(4-chlorophenyl)-1-phenyl-propan-1-one structure
|
Common Name | 3-(4-chlorophenyl)-1-phenyl-propan-1-one | ||
|---|---|---|---|---|
| CAS Number | 5739-39-9 | Molecular Weight | 244.71600 | |
| Density | 1.164g/cm3 | Boiling Point | 381.3ºC at 760 mmHg | |
| Molecular Formula | C15H13ClO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213ºC | |
| Name | 3-(4-chlorophenyl)-1-phenylpropan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.164g/cm3 |
|---|---|
| Boiling Point | 381.3ºC at 760 mmHg |
| Molecular Formula | C15H13ClO |
| Molecular Weight | 244.71600 |
| Flash Point | 213ºC |
| Exact Mass | 244.06500 |
| PSA | 17.07000 |
| LogP | 4.15550 |
| Index of Refraction | 1.583 |
| InChIKey | RHAMWHONYCOKTQ-UHFFFAOYSA-N |
| SMILES | O=C(CCc1ccc(Cl)cc1)c1ccccc1 |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 3-(p-chlorophenyl)-1-phenyl-1-propanone |
| 1-phenyl-3-(p-chlorophenyl)-1-propanone |
| 3-(4-CHLOROPHENYL)PROPIOPHENONE |
| 3-(p-chlorophenyl)-1-phenylpropan-1-one |
| 3-(4-chlorophenyl)-1-phenylpropanone |
| 3-(4-chlorophenyl)-1-phenyl-1-propanone |
| 3-(4-chloro-phenyl)-1-phenylpropan-1-one |