1,2-Naphthalenedione, 4-(ethylamino)- (9CI) structure
|
Common Name | 1,2-Naphthalenedione, 4-(ethylamino)- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 57404-52-1 | Molecular Weight | 201.22100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H11NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(ethylamino)naphthalene-1,2-dione |
|---|
| Molecular Formula | C12H11NO2 |
|---|---|
| Molecular Weight | 201.22100 |
| Exact Mass | 201.07900 |
| PSA | 46.17000 |
| LogP | 1.79330 |
| InChIKey | FSDPJIFZNXRVPK-UHFFFAOYSA-N |
| SMILES | CCNC1=CC(=O)C(=O)c2ccccc21 |
|
~%
1,2-Naphthalene... CAS#:57404-52-1 |
| Literature: Fieser; Fieser Journal of the American Chemical Society, 1935 , vol. 57, p. 491 |
|
~14%
1,2-Naphthalene... CAS#:57404-52-1
Detail
|
| Literature: Hartke, Klaus; Lohmann, Ulrike Chemistry Letters, 1983 , p. 693 - 696 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |