(4-amino-2-methyl-1H-pyrrol-3-yl)-phenylmethanone structure
|
Common Name | (4-amino-2-methyl-1H-pyrrol-3-yl)-phenylmethanone | ||
|---|---|---|---|---|
| CAS Number | 57436-07-4 | Molecular Weight | 200.23600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-amino-2-methyl-1H-pyrrol-3-yl)-phenylmethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H12N2O |
|---|---|
| Molecular Weight | 200.23600 |
| Exact Mass | 200.09500 |
| PSA | 58.88000 |
| LogP | 2.71750 |
| InChIKey | APPNFPAQYIBGLU-UHFFFAOYSA-N |
| SMILES | Cc1[nH]cc(N)c1C(=O)c1ccccc1 |
|
~%
(4-amino-2-meth... CAS#:57436-07-4 |
| Literature: Gruppo Lepetit S.p.A. Patent: US4402970 A1, 1983 ; |
|
~%
(4-amino-2-meth... CAS#:57436-07-4 |
| Literature: Abdalla; Sowell Sr. Journal of Heterocyclic Chemistry, 1990 , vol. 27, # 5 p. 1201 - 1207 |
|
~%
(4-amino-2-meth... CAS#:57436-07-4 |
| Literature: Abdalla; Sowell Sr. Journal of Heterocyclic Chemistry, 1990 , vol. 27, # 5 p. 1201 - 1207 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-methyl-3-benzoyl-4-aminopyrrole |
| 4-amino-3-benzoyl-2-methylpyrrole |