2,2,2-tricyclohexylethylphosphanium,iodide structure
|
Common Name | 2,2,2-tricyclohexylethylphosphanium,iodide | ||
|---|---|---|---|---|
| CAS Number | 57441-03-9 | Molecular Weight | 436.39400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H38IP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2,2-tricyclohexylethylphosphanium,iodide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H38IP |
|---|---|
| Molecular Weight | 436.39400 |
| Exact Mass | 436.17600 |
| PSA | 13.59000 |
| LogP | 7.58700 |
| InChIKey | SPZWEAAJWGHRIU-UHFFFAOYSA-N |
| SMILES | [I-].[PH3+]CC(C1CCCCC1)(C1CCCCC1)C1CCCCC1 |
|
~%
2,2,2-tricycloh... CAS#:57441-03-9 |
| Literature: Henderson,W.A.; Buckler,S.A. Journal of the American Chemical Society, 1960 , vol. 82, p. 5794 - 5800 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Phosphonium,tricyclohexylethyl-,iodide |
| Ethyl-tricyclohexyl-phosphonium |