[4-(nitrooxymethyl)-1,2,5-oxadiazol-3-yl]methyl nitrate structure
|
Common Name | [4-(nitrooxymethyl)-1,2,5-oxadiazol-3-yl]methyl nitrate | ||
|---|---|---|---|---|
| CAS Number | 57449-43-1 | Molecular Weight | 220.09700 | |
| Density | 1.698g/cm3 | Boiling Point | 377.6ºC at 760 mmHg | |
| Molecular Formula | C4H4N4O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.2ºC | |
| Name | [4-(nitrooxymethyl)-1,2,5-oxadiazol-3-yl]methyl nitrate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.698g/cm3 |
|---|---|
| Boiling Point | 377.6ºC at 760 mmHg |
| Molecular Formula | C4H4N4O7 |
| Molecular Weight | 220.09700 |
| Flash Point | 182.2ºC |
| Exact Mass | 220.00800 |
| PSA | 149.02000 |
| LogP | 0.53260 |
| Index of Refraction | 1.531 |
| InChIKey | FELQBVPTAWJQAO-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])OCc1nonc1CO[N+](=O)[O-] |
|
~84%
[4-(nitrooxymet... CAS#:57449-43-1 |
| Literature: Ivanova; Averina; Kuznetsova; Zefirov Chemistry of Heterocyclic Compounds, 2000 , vol. 36, # 9 p. 1091 - 1096 |
|
~%
[4-(nitrooxymet... CAS#:57449-43-1 |
| Literature: Ivanova; Averina; Kuznetsova; Zefirov Chemistry of Heterocyclic Compounds, 2000 , vol. 36, # 9 p. 1091 - 1096 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Dimethyl-flavazan-dinitrat |
| 3,4-bis-nitrooxymethyl-furazan |
| 4,5-Furazandimethanol dinitrate |