methyl 2-[(3-nitropyridin-2-yl)amino]acetate structure
|
Common Name | methyl 2-[(3-nitropyridin-2-yl)amino]acetate | ||
|---|---|---|---|---|
| CAS Number | 57461-53-7 | Molecular Weight | 211.17500 | |
| Density | 1.404g/cm3 | Boiling Point | 346.769ºC at 760 mmHg | |
| Molecular Formula | C8H9N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 163.52ºC | |
| Name | methyl 2-[(3-nitropyridin-2-yl)amino]acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.404g/cm3 |
|---|---|
| Boiling Point | 346.769ºC at 760 mmHg |
| Molecular Formula | C8H9N3O4 |
| Molecular Weight | 211.17500 |
| Flash Point | 163.52ºC |
| Exact Mass | 211.05900 |
| PSA | 97.04000 |
| LogP | 1.17090 |
| Index of Refraction | 1.601 |
| InChIKey | HQRFIOILJHNISR-UHFFFAOYSA-N |
| SMILES | COC(=O)CNc1ncccc1[N+](=O)[O-] |
| HS Code | 2933399090 |
|---|
|
~82%
methyl 2-[(3-ni... CAS#:57461-53-7 |
| Literature: Doise, Muriel; Blondeau, Dominique; Sliwa, Henri Heterocycles, 1992 , vol. 34, # 11 p. 2079 - 2093 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Methyl 2-((3-nitropyridin-2-yl)amino)acetate |