4-(4-Fluoro-2-methyl-1H-indol-5-yloxy)-6-methoxyquinazolin-7-ol structure
|
Common Name | 4-(4-Fluoro-2-methyl-1H-indol-5-yloxy)-6-methoxyquinazolin-7-ol | ||
|---|---|---|---|---|
| CAS Number | 574745-76-9 | Molecular Weight | 339.32000 | |
| Density | 1.438 | Boiling Point | 553.714ºC at 760 mmHg | |
| Molecular Formula | C18H14FN3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-6-methoxy-1H-quinazolin-7-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.438 |
|---|---|
| Boiling Point | 553.714ºC at 760 mmHg |
| Molecular Formula | C18H14FN3O3 |
| Molecular Weight | 339.32000 |
| Exact Mass | 339.10200 |
| PSA | 80.26000 |
| LogP | 4.06510 |
| Index of Refraction | 1.712 |
| InChIKey | BNDMWBMVOITFQA-UHFFFAOYSA-N |
| SMILES | COc1cc2c(Oc3ccc4[nH]c(C)cc4c3F)ncnc2cc1O |
| HS Code | 2933990090 |
|---|
|
~82%
4-(4-Fluoro-2-m... CAS#:574745-76-9 |
| Literature: Qian, Changgeng; Cai, Xiong; Zhai, Haixiao Patent: US2009/76044 A1, 2009 ; Location in patent: Page/Page column 28 ; US 20090076044 A1 |
|
~%
4-(4-Fluoro-2-m... CAS#:574745-76-9 |
| Literature: WO2008/53221 A2, ; Page/Page column 55-56 ; WO 2008/053221 A2 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| hin1686 |
| 4-(4-Fluoro-2-methyl-1H-indol-5-yloxy)-6-methoxyquinazolin-7-ol |