methyl 3-hydroxy-2,2-dimethoxy-4-methyl-pentanoate
methyl 3-hydroxy-2,2-dimethoxy-4-methyl-pentanoate structure
|
Common Name | methyl 3-hydroxy-2,2-dimethoxy-4-methyl-pentanoate | ||
|---|---|---|---|---|
| CAS Number | 57504-44-6 | Molecular Weight | 206.23600 | |
| Density | 1.076g/cm3 | Boiling Point | 278.1ºC at 760mmHg | |
| Molecular Formula | C9H18O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 99.8ºC | |
Summary: Methyl 3-hydroxy-2,2-dimethoxy-4-methylpentanoate, Chinese name 甲基3-羟基-2,2-二甲氧基-4-甲基戊酸酯, CAS number 57504-44-6, molecular formula C9H18O5, molecular weight 206.24, For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl 3-hydroxy-2,2-dimethoxy-4-methylpentanoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.076g/cm3 |
|---|---|
| Boiling Point | 278.1ºC at 760mmHg |
| Molecular Formula | C9H18O5 |
| Molecular Weight | 206.23600 |
| Flash Point | 99.8ºC |
| Exact Mass | 206.11500 |
| PSA | 64.99000 |
| LogP | 0.16540 |
| InChIKey | VQZMXNWENLDADQ-UHFFFAOYSA-N |
| SMILES | CC(C)C(C(C(=O)OC)(OC)OC)O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
methyl 3-hydrox... CAS#:57504-44-6 |
| Literature: Aben,R.W.; Scheeren,J.W. Synthesis, 1978 , p. 400 - 402 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the upstream materials of methyl 3-hydroxy-2,2-dimethoxy-4-methylpentanoate? |
| A: Related upstream materials(CAS) of methyl 3-hydroxy-2,2-dimethoxy-4-methylpentanoate: 1069-12-1;78-84-2. |
| Q: What is the molecular weight of methyl 3-hydroxy-2,2-dimethoxy-4-methylpentanoate? |
| A: Molecular weight of methyl 3-hydroxy-2,2-dimethoxy-4-methylpentanoate is 206.23600. |
| Q: What is the English name of methyl 3-hydroxy-2,2-dimethoxy-4-methylpentanoate? |
| A: The English name of methyl 3-hydroxy-2,2-dimethoxy-4-methylpentanoate is methyl 3-hydroxy-2,2-dimethoxy-4-methylpentanoate. |
| Q: What is the SMILES notation of methyl 3-hydroxy-2,2-dimethoxy-4-methylpentanoate? |
| A: SMILES notation of methyl 3-hydroxy-2,2-dimethoxy-4-methylpentanoate is CC(C)C(C(C(=O)OC)(OC)OC)O. |
| Q: What is the polar surface area (PSA) of methyl 3-hydroxy-2,2-dimethoxy-4-methylpentanoate? |
| A: Polar surface area (PSA) of methyl 3-hydroxy-2,2-dimethoxy-4-methylpentanoate is 64.99000. |
| Q: What is the Chinese name of 57504-44-6? |
| A: Chinese name of 57504-44-6 is 57504-44-6. |
| Q: What is the CAS number of methyl 3-hydroxy-2,2-dimethoxy-4-methylpentanoate? |
| A: CAS number of methyl 3-hydroxy-2,2-dimethoxy-4-methylpentanoate is 57504-44-6. |
| Q: What is the LogP of methyl 3-hydroxy-2,2-dimethoxy-4-methylpentanoate? |
| A: LogP of methyl 3-hydroxy-2,2-dimethoxy-4-methylpentanoate is 0.16540. |
| Q: What is the boiling point of methyl 3-hydroxy-2,2-dimethoxy-4-methylpentanoate? |
| A: Boiling point of methyl 3-hydroxy-2,2-dimethoxy-4-methylpentanoate is 278.1ºC at 760mmHg. |
| Q: What is the InChIKey of methyl 3-hydroxy-2,2-dimethoxy-4-methylpentanoate? |
| A: InChIKey of methyl 3-hydroxy-2,2-dimethoxy-4-methylpentanoate is VQZMXNWENLDADQ-UHFFFAOYSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |