N-(5-chloro-6-methoxy-quinolin-8-yl)-N,N-diethyl-hexane-1,6-diamine structure
|
Common Name | N-(5-chloro-6-methoxy-quinolin-8-yl)-N,N-diethyl-hexane-1,6-diamine | ||
|---|---|---|---|---|
| CAS Number | 57514-20-2 | Molecular Weight | 363.92500 | |
| Density | 1.109g/cm3 | Boiling Point | 516.6ºC at 760 mmHg | |
| Molecular Formula | C20H30ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 266.2ºC | |
| Name | 4-bromo-6-nitro-1,3-benzothiazol-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.109g/cm3 |
|---|---|
| Boiling Point | 516.6ºC at 760 mmHg |
| Molecular Formula | C20H30ClN3O |
| Molecular Weight | 363.92500 |
| Flash Point | 266.2ºC |
| Exact Mass | 363.20800 |
| PSA | 37.39000 |
| LogP | 5.28390 |
| Index of Refraction | 1.577 |
| InChIKey | YJYDXOOEIQLFBV-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCCCCCNc1cc(OC)c(Cl)c2cccnc12 |
|
~%
N-(5-chloro-6-m... CAS#:57514-20-2 |
| Literature: Drake et al. Journal of the American Chemical Society, 1946 , vol. 68, p. 1542 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| N,N-Diaethyl-N'-(5-chlor-6-methoxy-[8]chinolyl)-hexandiyldiamin |
| N,N-diethyl-N'-(5-chloro-1,2,3,4-tetrahydro-acridin-9-yl)-propanediyldiamine |
| N,N-Diaethyl-N'-(5-chlor-1,2,3,4-tetrahydro-acridin-9-yl)-propandiyldiamin |
| N,N-diethyl-N'-(5,6-dimethoxy-[8]quinolyl)-hexanediyldiamine |
| N,N-diethyl-N'-(5-chloro-6-methoxy-[8]quinolyl)-hexanediyldiamine |
| N,N-Diaethyl-N'-(5,6-dimethoxy-[8]chinolyl)-hexandiyldiamin |