Carbamothioic acid, N,N-diethyl-, S-[(4-chlorophenyl)methyl] ester mixt. with N2,N4-diethyl-6-(methylthio)-1,3,5-triazine-2,4-diamine structure
|
Common Name | Carbamothioic acid, N,N-diethyl-, S-[(4-chlorophenyl)methyl] ester mixt. with N2,N4-diethyl-6-(methylthio)-1,3,5-triazine-2,4-diamine | ||
|---|---|---|---|---|
| CAS Number | 57515-27-2 | Molecular Weight | 471.1 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H31ClN6OS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Carbamothioic acid, N,N-diethyl-, S-[(4-chlorophenyl)methyl] ester mixt. with N2,N4-diethyl-6-(methylthio)-1,3,5-triazine-2,4-diamine |
|---|
| Molecular Formula | C20H31ClN6OS2 |
|---|---|
| Molecular Weight | 471.1 |
| InChIKey | KXIJVOYRKIWNGN-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)SCc1ccc(Cl)cc1.CCNc1nc(NCC)nc(SC)n1 |