3,9-dimethyl-5-oxa-3,8,10-triazabicyclo[4.4.0]deca-8,11-dien-7-one structure
|
Common Name | 3,9-dimethyl-5-oxa-3,8,10-triazabicyclo[4.4.0]deca-8,11-dien-7-one | ||
|---|---|---|---|---|
| CAS Number | 5753-18-4 | Molecular Weight | 181.19200 | |
| Density | 1.43g/cm3 | Boiling Point | 295.7ºC at 760 mmHg | |
| Molecular Formula | C8H11N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 132.6ºC | |
| Name | 3,6-dimethyl-4,5-dihydro-2H-pyrimido[4,5-e][1,3]oxazin-8-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.43g/cm3 |
|---|---|
| Boiling Point | 295.7ºC at 760 mmHg |
| Molecular Formula | C8H11N3O2 |
| Molecular Weight | 181.19200 |
| Flash Point | 132.6ºC |
| Exact Mass | 181.08500 |
| PSA | 58.22000 |
| Index of Refraction | 1.651 |
| InChIKey | KWGOQFALNLOFRT-UHFFFAOYSA-N |
| SMILES | Cc1nc2c(c(=O)[nH]1)OCN(C)C2 |
|
~%
3,9-dimethyl-5-... CAS#:5753-18-4 |
| Literature: O'Brien,D.E. et al. Journal of Heterocyclic Chemistry, 1967 , vol. 4, p. 49 - 53 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3.6-Dimethyl-8-hydroxy-3.4-dihydro-2H-pyrimido<4.5-e>-1.3-oxazin |
| 3,6-Dimethylk-3,4-dihydro-2H-pyrimido<4.5-e>-1,3-oxazinol |