1-(5,6,7,8-Tetrahydro-naphthalen-2-yl)-piperazine; compound with (Z)-but-2-enedioic acid
Modify Date: 2025-09-24 08:14:52
1-(5,6,7,8-Tetrahydro-naphthalen-2-yl)-piperazine; compound with (Z)-but-2-enedioic acid structure
|
Common Name | 1-(5,6,7,8-Tetrahydro-naphthalen-2-yl)-piperazine; compound with (Z)-but-2-enedioic acid | ||
|---|---|---|---|---|
| CAS Number | 57537-11-8 | Molecular Weight | 332.39400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H24N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(5,6,7,8-Tetrahydro-naphthalen-2-yl)-piperazine; compound with (Z)-but-2-enedioic acid |
|---|
| Molecular Formula | C18H24N2O4 |
|---|---|
| Molecular Weight | 332.39400 |
| Exact Mass | 332.17400 |
| PSA | 89.87000 |
| LogP | 2.08060 |
| InChIKey | JEELGVPCLLMFSI-WLHGVMLRSA-N |
| SMILES | O=C(O)C=CC(=O)O.c1cc2c(cc1N1CCNCC1)CCCC2 |