2-methyl-N-(2-methylbut-3-en-2-ylsulfamoyl)but-3-en-2-amine structure
|
Common Name | 2-methyl-N-(2-methylbut-3-en-2-ylsulfamoyl)but-3-en-2-amine | ||
|---|---|---|---|---|
| CAS Number | 57542-28-6 | Molecular Weight | 232.34300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H20N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-methyl-N-(2-methylbut-3-en-2-ylsulfamoyl)but-3-en-2-amine |
|---|
| Molecular Formula | C10H20N2O2S |
|---|---|
| Molecular Weight | 232.34300 |
| Exact Mass | 232.12500 |
| PSA | 66.58000 |
| LogP | 3.20220 |
| InChIKey | KCMGAMKJIGKRLI-UHFFFAOYSA-N |
| SMILES | C=CC(C)(C)NS(=O)(=O)NC(C)(C)C=C |
|
~%
2-methyl-N-(2-m... CAS#:57542-28-6 |
| Literature: Engel,P.S.; Bishop,D.J. Journal of the American Chemical Society, 1975 , vol. 97, p. 6754 - 6762 |
|
~%
2-methyl-N-(2-m... CAS#:57542-28-6 |
| Literature: Engel,P.S.; Bishop,D.J. Journal of the American Chemical Society, 1975 , vol. 97, p. 6754 - 6762 |
|
~%
2-methyl-N-(2-m... CAS#:57542-28-6 |
| Literature: Engel,P.S.; Bishop,D.J. Journal of the American Chemical Society, 1975 , vol. 97, p. 6754 - 6762 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |