8-methoxy-2-(4-methoxyphenyl)-3-nitro-2H-chromene structure
|
Common Name | 8-methoxy-2-(4-methoxyphenyl)-3-nitro-2H-chromene | ||
|---|---|---|---|---|
| CAS Number | 57544-05-5 | Molecular Weight | 313.30500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H15NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 8-methoxy-2-(4-methoxyphenyl)-3-nitro-2H-chromene |
|---|
| Molecular Formula | C17H15NO5 |
|---|---|
| Molecular Weight | 313.30500 |
| Exact Mass | 313.09500 |
| PSA | 73.51000 |
| LogP | 3.97830 |
| InChIKey | JRKDJDBATCWDAD-UHFFFAOYSA-N |
| SMILES | COc1ccc(C2Oc3c(cccc3OC)C=C2[N+](=O)[O-])cc1 |
|
~%
8-methoxy-2-(4-... CAS#:57544-05-5 |
| Literature: Ono, Noboru; Sugi, Kiyoshi; Ogawa, Takuji; Aramaki, Shinji Journal of the Chemical Society, Chemical Communications, 1993 , # 23 p. 1781 - 1782 |
|
~%
8-methoxy-2-(4-... CAS#:57544-05-5 |
| Literature: Ono, Noboru; Sugi, Kiyoshi; Ogawa, Takuji; Aramaki, Shinji Journal of the Chemical Society, Chemical Communications, 1993 , # 23 p. 1781 - 1782 |