1-[2-(4-CHLOROPHENYL)-1,3-THIAZOL-5-YL]-1-ETHANONE structure
|
Common Name | 1-[2-(4-CHLOROPHENYL)-1,3-THIAZOL-5-YL]-1-ETHANONE | ||
|---|---|---|---|---|
| CAS Number | 57560-99-3 | Molecular Weight | 237.70500 | |
| Density | 1.314g/cm3 | Boiling Point | 378.1ºC at 760mmHg | |
| Molecular Formula | C11H8ClNOS | Melting Point | 150-152ºC | |
| MSDS | N/A | Flash Point | 182.5ºC | |
| Name | 1-[2-(4-chlorophenyl)-1,3-thiazol-5-yl]ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.314g/cm3 |
|---|---|
| Boiling Point | 378.1ºC at 760mmHg |
| Melting Point | 150-152ºC |
| Molecular Formula | C11H8ClNOS |
| Molecular Weight | 237.70500 |
| Flash Point | 182.5ºC |
| Exact Mass | 237.00200 |
| PSA | 58.20000 |
| LogP | 3.66610 |
| Index of Refraction | 1.604 |
| InChIKey | CAEMSQJRTZSWLF-UHFFFAOYSA-N |
| SMILES | CC(=O)c1cnc(-c2ccc(Cl)cc2)s1 |
| HS Code | 2934100090 |
|---|
|
~82%
1-[2-(4-CHLOROP... CAS#:57560-99-3 |
| Literature: Arcadi, Antonio; Attanasi, Orazio A.; Guidi, Barbara; Rossi, Elisabetta; Santeusanio, Stefania European Journal of Organic Chemistry, 1999 , # 11 p. 3117 - 3126 |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| chlorophenylthiazolylethanone |
| 5-Acetyl-2-(p-chlorphenyl)thiazol |
| 1-[2-(4-chlorophenyl)thiazol-5-yl]ethanone |