Monoacryloyloxyethy Methylhexahdrophthalate (MAMHP) structure
|
Common Name | Monoacryloyloxyethy Methylhexahdrophthalate (MAMHP) | ||
|---|---|---|---|---|
| CAS Number | 57567-84-7 | Molecular Weight | 186.20500 | |
| Density | 1.233g/cm3 | Boiling Point | 378.2ºC at 760 mmHg | |
| Molecular Formula | C9H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.7ºC | |
| Name | 4-methylcyclohexane-1,2-dicarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.233g/cm3 |
|---|---|
| Boiling Point | 378.2ºC at 760 mmHg |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.20500 |
| Flash Point | 196.7ºC |
| Exact Mass | 186.08900 |
| PSA | 74.60000 |
| LogP | 1.20800 |
| Index of Refraction | 1.502 |
| InChIKey | YWVFNWVZBAWOOY-UHFFFAOYSA-N |
| SMILES | CC1CCC(C(=O)O)C(C(=O)O)C1 |
| HS Code | 2917209090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2917209090 |
|---|---|
| Summary | 2917209090 other cyclanic, cyclenic or cyclotherpenic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| 4-methyl-1,2-cyclohexanedicarboxylic acid |
| 4-methyltetrahydrophthalic acid |
| Hexahydro-4-Methylphthalic Acid |
| 4-Methylhexahydrophthalic acid |
| Methylhexahydrophthalic acid |