3-benzyl-6-chloro-1H-pyrimidine-2,4-dione structure
|
Common Name | 3-benzyl-6-chloro-1H-pyrimidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 5759-76-2 | Molecular Weight | 236.65400 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H9ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-benzyl-6-chloro-1H-pyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Molecular Formula | C11H9ClN2O2 |
| Molecular Weight | 236.65400 |
| Exact Mass | 236.03500 |
| PSA | 55.12000 |
| LogP | 1.72 |
| Index of Refraction | 1.641 |
| InChIKey | HVFWAEIVJCCLQR-UHFFFAOYSA-N |
| SMILES | O=c1cc(Cl)[nH]c(=O)n1Cc1ccccc1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-Benzyl-4-chlor-uracil |
| HMS2883F21 |
| 3-benzyl-6-chlorouracil |
| 6-chloro-3-benzyl uracil |
| 2,4(1H,3H)-Pyrimidinedione, 6-chloro-3-(phenylmethyl)- |
| 3-Benzyl-6-chloro-2,4(1H,3H)-pyrimidinedione |