Isoquinoline, 4-iodo- structure
|
Common Name | Isoquinoline, 4-iodo- | ||
|---|---|---|---|---|
| CAS Number | 57611-53-7 | Molecular Weight | 268.73900 | |
| Density | 1.304g/cm3 | Boiling Point | 413.2ºC at 760 mmHg | |
| Molecular Formula | C13H17ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.7ºC | |
| Name | Isoquinoline, 4-iodo |
|---|---|
| Synonym | More Synonyms |
| Density | 1.304g/cm3 |
|---|---|
| Boiling Point | 413.2ºC at 760 mmHg |
| Molecular Formula | C13H17ClN2O2 |
| Molecular Weight | 268.73900 |
| Flash Point | 203.7ºC |
| Exact Mass | 268.09800 |
| PSA | 66.56000 |
| LogP | 2.35610 |
| Index of Refraction | 1.597 |
| InChIKey | ABDIXVFLGWCHDW-UHFFFAOYSA-N |
| SMILES | NC1(C(=O)O)CCN(Cc2ccc(Cl)cc2)CC1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-amino-1-[(4-chlorophenyl)methyl]piperidine-4-carboxylic acid |