Methyl 4-Amino-1-benzylpiperidine-4-carboxylate structure
|
Common Name | Methyl 4-Amino-1-benzylpiperidine-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 57611-57-1 | Molecular Weight | 248.32100 | |
| Density | 1.131g/cm3 | Boiling Point | 337.2ºC at 760 mmHg | |
| Molecular Formula | C14H20N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 157.7ºC | |
| Name | Methyl 4-Amino-1-benzylpiperidine-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.131g/cm3 |
|---|---|
| Boiling Point | 337.2ºC at 760 mmHg |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.32100 |
| Flash Point | 157.7ºC |
| Exact Mass | 248.15200 |
| PSA | 55.56000 |
| LogP | 1.79110 |
| Index of Refraction | 1.552 |
| InChIKey | GRSLQEBUAGDFDU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1(N)CCN(Cc2ccccc2)CC1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Methyl4-Amino-1-benzylpiperidine-4-carboxylate |
| 4-amino-1-benzyl-piperidine-4-carboxylic acid methyl ester |
| Amino-4-benzyl-1-isonipecotinsaeure-methylester |