4-benzylsulfanyl-N,6-dimethyl-1,3,5-triazin-2-amine structure
|
Common Name | 4-benzylsulfanyl-N,6-dimethyl-1,3,5-triazin-2-amine | ||
|---|---|---|---|---|
| CAS Number | 57639-48-2 | Molecular Weight | 246.33100 | |
| Density | 1.23g/cm3 | Boiling Point | 455.5ºC at 760 mmHg | |
| Molecular Formula | C12H14N4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 229.3ºC | |
| Name | 4-benzylsulfanyl-N,6-dimethyl-1,3,5-triazin-2-amine |
|---|
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 455.5ºC at 760 mmHg |
| Molecular Formula | C12H14N4S |
| Molecular Weight | 246.33100 |
| Flash Point | 229.3ºC |
| Exact Mass | 246.09400 |
| PSA | 79.23000 |
| LogP | 1.93590 |
| Index of Refraction | 1.625 |
| InChIKey | NQYBYIJBNCZHIN-UHFFFAOYSA-N |
| SMILES | CNc1nc(C)nc(SCc2ccccc2)n1 |
| HS Code | 2933699090 |
|---|
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |