4-Thiazolidinone,2-thioxo-3-[4-(trifluoromethyl)phenyl] structure
|
Common Name | 4-Thiazolidinone,2-thioxo-3-[4-(trifluoromethyl)phenyl] | ||
|---|---|---|---|---|
| CAS Number | 57669-54-2 | Molecular Weight | 277.28600 | |
| Density | 1.58g/cm3 | Boiling Point | 341.3ºC at 760mmHg | |
| Molecular Formula | C10H6F3NOS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 160.2ºC | |
| Name | 2-sulfanylidene-3-[4-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.58g/cm3 |
|---|---|
| Boiling Point | 341.3ºC at 760mmHg |
| Molecular Formula | C10H6F3NOS2 |
| Molecular Weight | 277.28600 |
| Flash Point | 160.2ºC |
| Exact Mass | 276.98400 |
| PSA | 77.70000 |
| LogP | 3.13510 |
| Index of Refraction | 1.633 |
| InChIKey | AJEXEUDSGYIZHZ-UHFFFAOYSA-N |
| SMILES | O=C1CSC(=S)N1c1ccc(C(F)(F)F)cc1 |
| HS Code | 2934999090 |
|---|
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Name: Inhibition of human DHODH using dihydroorotate substrate by DCIP assay
Source: ChEMBL
Target: Dihydroorotate dehydrogenase (quinone), mitochondrial
External Id: CHEMBL4262431
|
|
Name: Inhibition of human DHODH at 10 uM using dihydroorotate substrate by DCIP assay relat...
Source: ChEMBL
Target: Dihydroorotate dehydrogenase (quinone), mitochondrial
External Id: CHEMBL4262430
|
| 2-Thioxo-3-(4-trifluormethyl-phenyl)-thiazolidin-4-on |
| 2-thioxo-3-[4-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one |
| 3-(4-(trifluoromethyl)phenyl)-2-thioxothiazolidin-4-one |
| 2-thioxo-3-(4-trifluoromethyl-phenyl)-thiazolidin-4-one |