Methyl 2-(4-nitrophenyl)-2-oxoacetate structure
|
Common Name | Methyl 2-(4-nitrophenyl)-2-oxoacetate | ||
|---|---|---|---|---|
| CAS Number | 57699-27-1 | Molecular Weight | 209.15600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H7NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-nitro-phenyl)carbonyl-acetic acid methyl ester |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H7NO5 |
|---|---|
| Molecular Weight | 209.15600 |
| Exact Mass | 209.03200 |
| PSA | 89.19000 |
| LogP | 1.47370 |
| InChIKey | KCJNETLTNKSVGA-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=O)c1ccc([N+](=O)[O-])cc1 |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Methyl 2-(4-nitrophenyl)-2-oxoacetate |
| methyl (p-nitrophenyl)glyoxylate |
| methyl p-nitrobenzoylformate |
| methyl p-nitrophenylglyoxylate |
| methyl 4-nitrobenzoylmethanoate |