Ledol structure
|
Common Name | Ledol | ||
|---|---|---|---|---|
| CAS Number | 577-27-5 | Molecular Weight | 222.36600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H26O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of LedolLedol ((+)-Ledol) is an antifungal agent that can be isolated from the essential oil fractions of Rhododendron tomentosum. Ledol is also the expectorant and antitussive agent, which is simultaneously responsible for adverse reactions such as dizziness, nausea and vomiting[1]. |
| Name | (+)-ledol |
|---|---|
| Synonym | More Synonyms |
| Description | Ledol ((+)-Ledol) is an antifungal agent that can be isolated from the essential oil fractions of Rhododendron tomentosum. Ledol is also the expectorant and antitussive agent, which is simultaneously responsible for adverse reactions such as dizziness, nausea and vomiting[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C15H26O |
|---|---|
| Molecular Weight | 222.36600 |
| Exact Mass | 222.19800 |
| PSA | 20.23000 |
| LogP | 3.46570 |
| InChIKey | AYXPYQRXGNDJFU-MRMQSMEPSA-N |
| SMILES | CC1CCC2C1C1C(CCC2(C)O)C1(C)C |
|
Name: Partition coefficient, log K of the compound in n-hexane/methyl tert-butylether/aceto...
Source: ChEMBL
Target: N/A
External Id: CHEMBL3123995
|
| (1aR-(1aα,4α,4aβ,7α,7aβ,7bα))-decahydro-1,1,4,7-tetramethyl-1H-cycloprop[e]azulen-4-ol |
| (1aR,4R,4aS,7R,7aS,7bS)-1,1,4,7-Tetramethyl-decahydro-cyclopropa[e]azulen-4-ol |