3-Pentene-1,3,4-tricarboxylic acid
3-Pentene-1,3,4-tricarboxylic acid structure
|
Common Name | 3-Pentene-1,3,4-tricarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 577-53-7 | Molecular Weight | 202.16100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H10O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 1-Methylbut-1-ene-1,2,4-tricarboxylic acid (3-Pentene-1,3,4-tricarboxylic acid), Chinese name is 1-甲基戊-1-烯-1,2,4-三羧酸, CAS number is 577-53-7, molecular formula is C8H10O6, molecular weight is 202.16100. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-methylbut-1-ene-1,2,4-tricarboxylic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H10O6 |
|---|---|
| Molecular Weight | 202.16100 |
| Exact Mass | 202.04800 |
| PSA | 111.90000 |
| LogP | 0.33690 |
| InChIKey | GDSOZVZXVXTJMI-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)=C(CCC(=O)O)C(=O)O |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:487-66-1This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-Pentene-1,3,4-tricarboxylic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 1-methylbut-1-ene-1,2,4-tricarboxylic acid? |
| A: SMILES notation of 1-methylbut-1-ene-1,2,4-tricarboxylic acid is CC(C(=O)O)=C(CCC(=O)O)C(=O)O. |
| Q: What is the Chinese name of 577-53-7? |
| A: Chinese name of 577-53-7 is 577-53-7. |
| Q: What is the LogP of 1-methylbut-1-ene-1,2,4-tricarboxylic acid? |
| A: LogP of 1-methylbut-1-ene-1,2,4-tricarboxylic acid is 0.33690. |
| Q: What English synonyms does 1-methylbut-1-ene-1,2,4-tricarboxylic acid have? |
| A: English synonyms of 1-methylbut-1-ene-1,2,4-tricarboxylic acid: 3-Pentene-1,3,4-tricarboxylic acid. |
| Q: What is the polar surface area (PSA) of 1-methylbut-1-ene-1,2,4-tricarboxylic acid? |
| A: Polar surface area (PSA) of 1-methylbut-1-ene-1,2,4-tricarboxylic acid is 111.90000. |
| Q: What is the molecular formula of 1-methylbut-1-ene-1,2,4-tricarboxylic acid? |
| A: Molecular formula of 1-methylbut-1-ene-1,2,4-tricarboxylic acid is C8H10O6. |
| Q: What is the CAS number of 1-methylbut-1-ene-1,2,4-tricarboxylic acid? |
| A: CAS number of 1-methylbut-1-ene-1,2,4-tricarboxylic acid is 577-53-7. |
| Q: What are the downstream products of 1-methylbut-1-ene-1,2,4-tricarboxylic acid? |
| A: Related downstream products(CAS) of 1-methylbut-1-ene-1,2,4-tricarboxylic acid: 487-66-1. |
| Q: What is the InChIKey of 1-methylbut-1-ene-1,2,4-tricarboxylic acid? |
| A: InChIKey of 1-methylbut-1-ene-1,2,4-tricarboxylic acid is GDSOZVZXVXTJMI-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 1-methylbut-1-ene-1,2,4-tricarboxylic acid? |
| A: Molecular weight of 1-methylbut-1-ene-1,2,4-tricarboxylic acid is 202.16100. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |