1,4-Naphthalenedione,6,7-dichloro- structure
|
Common Name | 1,4-Naphthalenedione,6,7-dichloro- | ||
|---|---|---|---|---|
| CAS Number | 577-67-3 | Molecular Weight | 227.04400 | |
| Density | 1.55g/cm3 | Boiling Point | 410.6ºC at 760mmHg | |
| Molecular Formula | C10H4Cl2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173.5ºC | |
| Name | 6,7-dichloronaphthalene-1,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.55g/cm3 |
|---|---|
| Boiling Point | 410.6ºC at 760mmHg |
| Molecular Formula | C10H4Cl2O2 |
| Molecular Weight | 227.04400 |
| Flash Point | 173.5ºC |
| Exact Mass | 225.95900 |
| PSA | 34.14000 |
| LogP | 2.92860 |
| Index of Refraction | 1.638 |
| InChIKey | WHCHEHXXUJTVHP-UHFFFAOYSA-N |
| SMILES | O=C1C=CC(=O)c2cc(Cl)c(Cl)cc21 |
|
~%
1,4-Naphthalene... CAS#:577-67-3 |
| Literature: Ashnagar, Alamdar; Bruce, J. Malcolm; Lloyd-Williams, Paul Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1988 , p. 559 - 562 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,4-Naphthalenedione,6,7-dichloro |
| 2,3-dichloro-1,4-naphthoquinone |